C24H22F3N5O — CID 145298823
4'-(4-methylphenyl)-5'-(2H-tetrazol-5-yl)-5-(3,3,3-trifluoropropyl)spiro[1,3-dihydroindene-2,2'-1,3-dihydropyridine]-6'-one (PubChem CID 145298823) has the molecular formula C24H22F3N5O and a molecular weight of 453.47 g/mol. Its IUPAC name is 4'-(4-methylphenyl)-5'-(2H-tetrazol-5-yl)-5-(3,3,3-trifluoropropyl)spiro[1,3-dihydroindene-2,2'-1,3-dihydropyridine]-6'-one.
| Compound Name | 4'-(4-methylphenyl)-5'-(2H-tetrazol-5-yl)-5-(3,3,3-trifluoropropyl)spiro[1,3-dihydroindene-2,2'-1,3-dihydropyridine]-6'-one |
|---|---|
| PubChem CID | 145298823 |
| Molecular Formula | C24H22F3N5O |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 4'-(4-methylphenyl)-5'-(2H-tetrazol-5-yl)-5-(3,3,3-trifluoropropyl)spiro[1,3-dihydroindene-2,2'-1,3-dihydropyridine]-6'-one |
| SMILES | Cc1ccc(C2=C(c3nn[nH]n3)C(=O)NC3(C2)Cc2ccc(CCC(F)(F)F)cc2C3)cc1 |
| InChI | InChI=1S/C24H22F3N5O/c1-14-2-5-16(6-3-14)19-13-23(28-22(33)20(19)21-29-31-32-30-21)11-17-7-4-15(10-18(17)12-23)8-9-24(25,26)27/h2-7,10H,8-9,11-13H2,1H3,(H,28,33)(H,29,30,31,32) |
| InChIKey | OLLLYMYOYNMRMG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |