C9H14 — CID 14529887
1,1-bis(prop-1-en-2-yl)cyclopropane (PubChem CID 14529887) has the molecular formula C9H14 and a molecular weight of 122.21 g/mol. Its IUPAC name is 1,1-bis(prop-1-en-2-yl)cyclopropane.
| Compound Name | 1,1-bis(prop-1-en-2-yl)cyclopropane |
|---|---|
| PubChem CID | 14529887 |
| Molecular Formula | C9H14 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | 1,1-bis(prop-1-en-2-yl)cyclopropane |
| SMILES | C=C(C)C1(C(=C)C)CC1 |
| InChI | InChI=1S/C9H14/c1-7(2)9(5-6-9)8(3)4/h1,3,5-6H2,2,4H3 |
| InChIKey | XAUYUJAQOOCNHW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|