C22H22F5NO2 — CID 145298915
2-[(1R)-1-amino-2,2-difluoro-5-(4,4,4-trifluorobutoxy)-3H-inden-1-yl]-1-(4-methylphenyl)ethanone (PubChem CID 145298915) has the molecular formula C22H22F5NO2 and a molecular weight of 427.41 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2-difluoro-5-(4,4,4-trifluorobutoxy)-3H-inden-1-yl]-1-(4-methylphenyl)ethanone.
| Compound Name | 2-[(1R)-1-amino-2,2-difluoro-5-(4,4,4-trifluorobutoxy)-3H-inden-1-yl]-1-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 145298915 |
| Molecular Formula | C22H22F5NO2 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-[(1R)-1-amino-2,2-difluoro-5-(4,4,4-trifluorobutoxy)-3H-inden-1-yl]-1-(4-methylphenyl)ethanone |
| SMILES | Cc1ccc(C(=O)C[C@@]2(N)c3ccc(OCCCC(F)(F)F)cc3CC2(F)F)cc1 |
| InChI | InChI=1S/C22H22F5NO2/c1-14-3-5-15(6-4-14)19(29)13-20(28)18-8-7-17(11-16(18)12-21(20,23)24)30-10-2-9-22(25,26)27/h3-8,11H,2,9-10,12-13,28H2,1H3/t20-/m1/s1 |
| InChIKey | XCKZMKMKNUFGJM-HXUWFJFHSA-N |
| XLogP | 5.33 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|