C24H26F3N3O2 — CID 145298993
(3S)-4'-(5-azaspiro[2.4]heptan-5-yl)-6'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,2'-1,3-dihydropyridine]-5'-carbonitrile (PubChem CID 145298993) has the molecular formula C24H26F3N3O2 and a molecular weight of 445.49 g/mol. Its IUPAC name is (3S)-4'-(5-azaspiro[2.4]heptan-5-yl)-6'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,2'-1,3-dihydropyridine]-5'-carbonitrile.
| Compound Name | (3S)-4'-(5-azaspiro[2.4]heptan-5-yl)-6'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,2'-1,3-dihydropyridine]-5'-carbonitrile |
|---|---|
| PubChem CID | 145298993 |
| Molecular Formula | C24H26F3N3O2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | (3S)-4'-(5-azaspiro[2.4]heptan-5-yl)-6'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,2'-1,3-dihydropyridine]-5'-carbonitrile |
| SMILES | N#CC1=C(N2CCC3(CC3)C2)C[C@]2(CCc3cc(OCCCC(F)(F)F)ccc32)NC1=O |
| InChI | InChI=1S/C24H26F3N3O2/c25-24(26,27)5-1-11-32-17-2-3-19-16(12-17)4-6-23(19)13-20(18(14-28)21(31)29-23)30-10-9-22(15-30)7-8-22/h2-3,12H,1,4-11,13,15H2,(H,29,31)/t23-/m0/s1 |
| InChIKey | PZFKQUMWAIRLNZ-QHCPKHFHSA-N |
| XLogP | 4.33 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|