About 2-[(2E)-2-ethenylpenta-2,4-dienyl]-5-methylpyridazin-3-one
2-[(2E)-2-ethenylpenta-2,4-dienyl]-5-methylpyridazin-3-one (PubChem CID 145299054) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-[(2E)-2-ethenylpenta-2,4-dienyl]-5-methylpyridazin-3-one.
Molecular Properties
| Compound Name | 2-[(2E)-2-ethenylpenta-2,4-dienyl]-5-methylpyridazin-3-one |
| PubChem CID | 145299054 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-[(2E)-2-ethenylpenta-2,4-dienyl]-5-methylpyridazin-3-one |
| SMILES | C=C/C=C(\C=C)Cn1ncc(C)cc1=O |
| InChI | InChI=1S/C12H14N2O/c1-4-6-11(5-2)9-14-12(15)7-10(3)8-13-14/h4-8H,1-2,9H2,3H3/b11-6+ |
| InChIKey | LABJENDISYXFJI-IZZDOVSWSA-N |
| XLogP | 1.85 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2E)-2-ethenylpenta-2,4-dienyl]-5-methylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2E)-2-ethenylpenta-2,4-dienyl]-5-methylpyridazin-3-one?
The IUPAC name of 2-[(2E)-2-ethenylpenta-2,4-dienyl]-5-methylpyridazin-3-one (CID 145299054) is 2-[(2E)-2-ethenylpenta-2,4-dienyl]-5-methylpyridazin-3-one.
What is the SMILES notation for 2-[(2E)-2-ethenylpenta-2,4-dienyl]-5-methylpyridazin-3-one?
The canonical SMILES for 2-[(2E)-2-ethenylpenta-2,4-dienyl]-5-methylpyridazin-3-one is C=C/C=C(\C=C)Cn1ncc(C)cc1=O.
What is the InChIKey of 2-[(2E)-2-ethenylpenta-2,4-dienyl]-5-methylpyridazin-3-one?
The InChIKey is LABJENDISYXFJI-IZZDOVSWSA-N. The full InChI is InChI=1S/C12H14N2O/c1-4-6-11(5-2)9-14-12(15)7-10(3)8-13-14/h4-8H,1-2,9H2,3H3/b11-6+.
What are the key properties of 2-[(2E)-2-ethenylpenta-2,4-dienyl]-5-methylpyridazin-3-one?
2-[(2E)-2-ethenylpenta-2,4-dienyl]-5-methylpyridazin-3-one has a molecular weight of 202.26 g/mol, XLogP of 1.85, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2E)-2-ethenylpenta-2,4-dienyl]-5-methylpyridazin-3-one is sourced from PubChem (CID 145299054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).