About (Z)-2-(2-butylcyclopentyl)-N-methyloct-2-en-4-imine;2-fluoro-3-methylbuta-1,3-diene
(Z)-2-(2-butylcyclopentyl)-N-methyloct-2-en-4-imine;2-fluoro-3-methylbuta-1,3-diene (PubChem CID 145299314) has the molecular formula C23H40FN
and a molecular weight of 349.58 g/mol. Its IUPAC name is (Z)-2-(2-butylcyclopentyl)-N-methyloct-2-en-4-imine;2-fluoro-3-methylbuta-1,3-diene.
Molecular Properties
| Compound Name | (Z)-2-(2-butylcyclopentyl)-N-methyloct-2-en-4-imine;2-fluoro-3-methylbuta-1,3-diene |
| PubChem CID | 145299314 |
| Molecular Formula | C23H40FN |
| Molecular Weight | 349.58 g/mol |
| Exact Mass | 349.31 |
| IUPAC Name | (Z)-2-(2-butylcyclopentyl)-N-methyloct-2-en-4-imine;2-fluoro-3-methylbuta-1,3-diene |
| SMILES | C=C(C)C(=C)F.CCCCC(/C=C(/C)C1CCCC1CCCC)=N\C |
| InChI | InChI=1S/C18H33N.C5H7F/c1-5-7-10-16-11-9-13-18(16)15(3)14-17(19-4)12-8-6-2;1-4(2)5(3)6/h14,16,18H,5-13H2,1-4H3;1,3H2,2H3/b15-14-,19-17+; |
| InChIKey | XEHOEVDYESWKHN-TZJNYYINSA-N |
| XLogP | 7.85 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.58 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(2-butylcyclopentyl)-N-methyloct-2-en-4-imine;2-fluoro-3-methylbuta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(2-butylcyclopentyl)-N-methyloct-2-en-4-imine;2-fluoro-3-methylbuta-1,3-diene?
The IUPAC name of (Z)-2-(2-butylcyclopentyl)-N-methyloct-2-en-4-imine;2-fluoro-3-methylbuta-1,3-diene (CID 145299314) is (Z)-2-(2-butylcyclopentyl)-N-methyloct-2-en-4-imine;2-fluoro-3-methylbuta-1,3-diene.
What is the SMILES notation for (Z)-2-(2-butylcyclopentyl)-N-methyloct-2-en-4-imine;2-fluoro-3-methylbuta-1,3-diene?
The canonical SMILES for (Z)-2-(2-butylcyclopentyl)-N-methyloct-2-en-4-imine;2-fluoro-3-methylbuta-1,3-diene is C=C(C)C(=C)F.CCCCC(/C=C(/C)C1CCCC1CCCC)=N\C.
What is the InChIKey of (Z)-2-(2-butylcyclopentyl)-N-methyloct-2-en-4-imine;2-fluoro-3-methylbuta-1,3-diene?
The InChIKey is XEHOEVDYESWKHN-TZJNYYINSA-N. The full InChI is InChI=1S/C18H33N.C5H7F/c1-5-7-10-16-11-9-13-18(16)15(3)14-17(19-4)12-8-6-2;1-4(2)5(3)6/h14,16,18H,5-13H2,1-4H3;1,3H2,2H3/b15-14-,19-17+;.
What are the key properties of (Z)-2-(2-butylcyclopentyl)-N-methyloct-2-en-4-imine;2-fluoro-3-methylbuta-1,3-diene?
(Z)-2-(2-butylcyclopentyl)-N-methyloct-2-en-4-imine;2-fluoro-3-methylbuta-1,3-diene has a molecular weight of 349.58 g/mol, XLogP of 7.85, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(2-butylcyclopentyl)-N-methyloct-2-en-4-imine;2-fluoro-3-methylbuta-1,3-diene is sourced from PubChem (CID 145299314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).