C28H26ClN — CID 145299888
1-chloro-3-(3-methylphenyl)benzene;(Z)-1,3-diphenylprop-1-en-1-amine (PubChem CID 145299888) has the molecular formula C28H26ClN and a molecular weight of 411.98 g/mol. Its IUPAC name is 1-chloro-3-(3-methylphenyl)benzene;(Z)-1,3-diphenylprop-1-en-1-amine.
| Compound Name | 1-chloro-3-(3-methylphenyl)benzene;(Z)-1,3-diphenylprop-1-en-1-amine |
|---|---|
| PubChem CID | 145299888 |
| Molecular Formula | C28H26ClN |
| Molecular Weight | 411.98 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-chloro-3-(3-methylphenyl)benzene;(Z)-1,3-diphenylprop-1-en-1-amine |
| SMILES | Cc1cccc(-c2cccc(Cl)c2)c1.N/C(=C\Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H15N.C13H11Cl/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13;1-10-4-2-5-11(8-10)12-6-3-7-13(14)9-12/h1-10,12H,11,16H2;2-9H,1H3/b15-12-; |
| InChIKey | IQPKLEBQNOHDCF-OBBOLZQKSA-N |
| XLogP | 7.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.98 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |