C24H38N4 — CID 145300366
(1R,8R)-10-(cyclohexylmethyl)-9-methyl-5-(4-methylpiperazin-1-yl)-9,10-diazatricyclo[6.4.1.02,7]trideca-2(7),3,5-triene (PubChem CID 145300366) has the molecular formula C24H38N4 and a molecular weight of 382.60 g/mol. Its IUPAC name is (1R,8R)-10-(cyclohexylmethyl)-9-methyl-5-(4-methylpiperazin-1-yl)-9,10-diazatricyclo[6.4.1.02,7]trideca-2(7),3,5-triene.
| Compound Name | (1R,8R)-10-(cyclohexylmethyl)-9-methyl-5-(4-methylpiperazin-1-yl)-9,10-diazatricyclo[6.4.1.02,7]trideca-2(7),3,5-triene |
|---|---|
| PubChem CID | 145300366 |
| Molecular Formula | C24H38N4 |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | (1R,8R)-10-(cyclohexylmethyl)-9-methyl-5-(4-methylpiperazin-1-yl)-9,10-diazatricyclo[6.4.1.02,7]trideca-2(7),3,5-triene |
| SMILES | CN1CCN(c2ccc3c(c2)[C@H]2C[C@H]3CCN(CC3CCCCC3)N2C)CC1 |
| InChI | InChI=1S/C24H38N4/c1-25-12-14-27(15-13-25)21-8-9-22-20-10-11-28(18-19-6-4-3-5-7-19)26(2)24(16-20)23(22)17-21/h8-9,17,19-20,24H,3-7,10-16,18H2,1-2H3/t20-,24-/m1/s1 |
| InChIKey | LHXLUVMRBHJISK-HYBUGGRVSA-N |
| XLogP | 4.10 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |