C24H34N2 — CID 145300491
N,4-dimethyl-2-[(E)-2-[3-(3-methylhexylamino)phenyl]prop-1-enyl]aniline (PubChem CID 145300491) has the molecular formula C24H34N2 and a molecular weight of 350.55 g/mol. Its IUPAC name is N,4-dimethyl-2-[(E)-2-[3-(3-methylhexylamino)phenyl]prop-1-enyl]aniline.
| Compound Name | N,4-dimethyl-2-[(E)-2-[3-(3-methylhexylamino)phenyl]prop-1-enyl]aniline |
|---|---|
| PubChem CID | 145300491 |
| Molecular Formula | C24H34N2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | N,4-dimethyl-2-[(E)-2-[3-(3-methylhexylamino)phenyl]prop-1-enyl]aniline |
| SMILES | CCCC(C)CCNc1cccc(/C(C)=C/c2cc(C)ccc2NC)c1 |
| InChI | InChI=1S/C24H34N2/c1-6-8-18(2)13-14-26-23-10-7-9-21(17-23)20(4)16-22-15-19(3)11-12-24(22)25-5/h7,9-12,15-18,25-26H,6,8,13-14H2,1-5H3/b20-16+ |
| InChIKey | VPJZCAVMIWDXLQ-CAPFRKAQSA-N |
| XLogP | 6.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|