C17H30N2O — CID 145300627
N-[(3E,5Z)-2-amino-3-methylhepta-3,5-dienyl]-2,5-dimethylcyclohexane-1-carboxamide (PubChem CID 145300627) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is N-[(3E,5Z)-2-amino-3-methylhepta-3,5-dienyl]-2,5-dimethylcyclohexane-1-carboxamide.
| Compound Name | N-[(3E,5Z)-2-amino-3-methylhepta-3,5-dienyl]-2,5-dimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 145300627 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | N-[(3E,5Z)-2-amino-3-methylhepta-3,5-dienyl]-2,5-dimethylcyclohexane-1-carboxamide |
| SMILES | C/C=C\C=C(/C)C(N)CNC(=O)C1CC(C)CCC1C |
| InChI | InChI=1S/C17H30N2O/c1-5-6-7-14(4)16(18)11-19-17(20)15-10-12(2)8-9-13(15)3/h5-7,12-13,15-16H,8-11,18H2,1-4H3,(H,19,20)/b6-5-,14-7+ |
| InChIKey | HGWQTKGWIAPTLC-NTBKVEBNSA-N |
| XLogP | 3.02 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|