C16H29F2NO2 — CID 145300768
3,3-difluoro-4-methylpentanoic acid;ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine (PubChem CID 145300768) has the molecular formula C16H29F2NO2 and a molecular weight of 305.41 g/mol. Its IUPAC name is 3,3-difluoro-4-methylpentanoic acid;ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine.
| Compound Name | 3,3-difluoro-4-methylpentanoic acid;ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 145300768 |
| Molecular Formula | C16H29F2NO2 |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 3,3-difluoro-4-methylpentanoic acid;ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine |
| SMILES | C=C/C=C(\C=C/C)CN.CC.CC(C)C(F)(F)CC(=O)O |
| InChI | InChI=1S/C8H13N.C6H10F2O2.C2H6/c1-3-5-8(7-9)6-4-2;1-4(2)6(7,8)3-5(9)10;1-2/h3-6H,1,7,9H2,2H3;4H,3H2,1-2H3,(H,9,10);1-2H3/b6-4-,8-5+;; |
| InChIKey | XSLRQJKCJXSPQT-WGVBJJOMSA-N |
| XLogP | 4.41 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|