C14H21F2NO2 — CID 145300792
2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-5,5-difluoro-4,4-dimethylpentanoic acid (PubChem CID 145300792) has the molecular formula C14H21F2NO2 and a molecular weight of 273.32 g/mol. Its IUPAC name is 2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-5,5-difluoro-4,4-dimethylpentanoic acid.
| Compound Name | 2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-5,5-difluoro-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 145300792 |
| Molecular Formula | C14H21F2NO2 |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-5,5-difluoro-4,4-dimethylpentanoic acid |
| SMILES | C=C/C=C(\C=C)CNC(CC(C)(C)C(F)F)C(=O)O |
| InChI | InChI=1S/C14H21F2NO2/c1-5-7-10(6-2)9-17-11(12(18)19)8-14(3,4)13(15)16/h5-7,11,13,17H,1-2,8-9H2,3-4H3,(H,18,19)/b10-7+ |
| InChIKey | YXTXVKDFWSFIMY-JXMROGBWSA-N |
| XLogP | 3.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|