C31H45NO3 — CID 145300949
(6aS,6bS,8aS,11R,12aR,14aR)-11-[amino(hydroxy)methyl]-3-ethoxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one (PubChem CID 145300949) has the molecular formula C31H45NO3 and a molecular weight of 479.71 g/mol. Its IUPAC name is (6aS,6bS,8aS,11R,12aR,14aR)-11-[amino(hydroxy)methyl]-3-ethoxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one.
| Compound Name | (6aS,6bS,8aS,11R,12aR,14aR)-11-[amino(hydroxy)methyl]-3-ethoxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one |
|---|---|
| PubChem CID | 145300949 |
| Molecular Formula | C31H45NO3 |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 479.34 |
| IUPAC Name | (6aS,6bS,8aS,11R,12aR,14aR)-11-[amino(hydroxy)methyl]-3-ethoxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one |
| SMILES | CCOC1=C(C)C2=CC=C3[C@@](C)(CC[C@@]4(C)[C@@H]5C[C@](C)(C(N)O)CC[C@]5(C)CC[C@]34C)C2=CC1=O |
| InChI | InChI=1S/C31H45NO3/c1-8-35-25-19(2)20-9-10-23-29(5,21(20)17-22(25)33)14-16-31(7)24-18-28(4,26(32)34)12-11-27(24,3)13-15-30(23,31)6/h9-10,17,24,26,34H,8,11-16,18,32H2,1-7H3/t24-,26?,27-,28-,29+,30-,31+/m1/s1 |
| InChIKey | VIHAJWAXAOCDGF-KAZOBLPNSA-N |
| XLogP | 6.37 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|