C35H49NO3 — CID 145300981
(2R,4aS,6aR,6aS,14aS,14bR)-2,4a,6a,6a,9,14a,14b-heptamethyl-10-(3-methylbut-2-enoxy)-11-oxo-3,4,5,6,13,14-hexahydro-1H-picene-2-carboxamide (PubChem CID 145300981) has the molecular formula C35H49NO3 and a molecular weight of 531.78 g/mol. Its IUPAC name is (2R,4aS,6aR,6aS,14aS,14bR)-2,4a,6a,6a,9,14a,14b-heptamethyl-10-(3-methylbut-2-enoxy)-11-oxo-3,4,5,6,13,14-hexahydro-1H-picene-2-carboxamide.
| Compound Name | (2R,4aS,6aR,6aS,14aS,14bR)-2,4a,6a,6a,9,14a,14b-heptamethyl-10-(3-methylbut-2-enoxy)-11-oxo-3,4,5,6,13,14-hexahydro-1H-picene-2-carboxamide |
|---|---|
| PubChem CID | 145300981 |
| Molecular Formula | C35H49NO3 |
| Molecular Weight | 531.78 g/mol |
| Exact Mass | 531.37 |
| IUPAC Name | (2R,4aS,6aR,6aS,14aS,14bR)-2,4a,6a,6a,9,14a,14b-heptamethyl-10-(3-methylbut-2-enoxy)-11-oxo-3,4,5,6,13,14-hexahydro-1H-picene-2-carboxamide |
| SMILES | CC(C)=CCOC1=C(C)C2=CC=C3[C@@](C)(CC[C@@]4(C)[C@]5(C)C[C@](C)(C(N)=O)CC[C@]5(C)CC[C@]34C)C2=CC1=O |
| InChI | InChI=1S/C35H49NO3/c1-22(2)12-19-39-28-23(3)24-10-11-27-32(6,25(24)20-26(28)37)16-18-34(8)33(27,7)17-15-31(5)14-13-30(4,29(36)38)21-35(31,34)9/h10-12,20H,13-19,21H2,1-9H3,(H2,36,38)/t30-,31-,32+,33-,34-,35-/m1/s1 |
| InChIKey | NBDMYQRLYXTMGP-AXLHTJFBSA-N |
| XLogP | 7.91 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.78 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|