C22H19F2N3O4S — CID 145301717
6-[4-(ethylsulfonylmethyl)-2-azabicyclo[4.4.1]undeca-1(10),2,4,6,8-pentaen-3-yl]-2,2-difluoro-7-methyl-[1,3]dioxolo[4,5-f]benzimidazole (PubChem CID 145301717) has the molecular formula C22H19F2N3O4S and a molecular weight of 459.47 g/mol. Its IUPAC name is 6-[4-(ethylsulfonylmethyl)-2-azabicyclo[4.4.1]undeca-1(10),2,4,6,8-pentaen-3-yl]-2,2-difluoro-7-methyl-[1,3]dioxolo[4,5-f]benzimidazole.
| Compound Name | 6-[4-(ethylsulfonylmethyl)-2-azabicyclo[4.4.1]undeca-1(10),2,4,6,8-pentaen-3-yl]-2,2-difluoro-7-methyl-[1,3]dioxolo[4,5-f]benzimidazole |
|---|---|
| PubChem CID | 145301717 |
| Molecular Formula | C22H19F2N3O4S |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 6-[4-(ethylsulfonylmethyl)-2-azabicyclo[4.4.1]undeca-1(10),2,4,6,8-pentaen-3-yl]-2,2-difluoro-7-methyl-[1,3]dioxolo[4,5-f]benzimidazole |
| SMILES | CCS(=O)(=O)CC1=CC2=CC=CC=C(C2)N=C1c1nc2cc3c(cc2n1C)OC(F)(F)O3 |
| InChI | InChI=1S/C22H19F2N3O4S/c1-3-32(28,29)12-14-8-13-6-4-5-7-15(9-13)25-20(14)21-26-16-10-18-19(11-17(16)27(21)2)31-22(23,24)30-18/h4-8,10-11H,3,9,12H2,1-2H3 |
| InChIKey | WPLJKVHWAIRCBD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |