C26H31F2N3 — CID 145301979
3-[4-[(1E,3E)-4-[(4E)-5,5-difluoro-2-methyl-3-methylidene-4-prop-2-enylidenecyclopenten-1-yl]-2,3-dimethylbuta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptane (PubChem CID 145301979) has the molecular formula C26H31F2N3 and a molecular weight of 423.55 g/mol. Its IUPAC name is 3-[4-[(1E,3E)-4-[(4E)-5,5-difluoro-2-methyl-3-methylidene-4-prop-2-enylidenecyclopenten-1-yl]-2,3-dimethylbuta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptane.
| Compound Name | 3-[4-[(1E,3E)-4-[(4E)-5,5-difluoro-2-methyl-3-methylidene-4-prop-2-enylidenecyclopenten-1-yl]-2,3-dimethylbuta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 145301979 |
| Molecular Formula | C26H31F2N3 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 3-[4-[(1E,3E)-4-[(4E)-5,5-difluoro-2-methyl-3-methylidene-4-prop-2-enylidenecyclopenten-1-yl]-2,3-dimethylbuta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptane |
| SMILES | C=C/C=C1\C(=C)C(C)=C(/C=C(C)/C(C)=C/c2nc(C3NC4CCC3C4)[nH]c2C)C1(F)F |
| InChI | InChI=1S/C26H31F2N3/c1-7-8-21-16(4)17(5)22(26(21,27)28)11-14(2)15(3)12-23-18(6)29-25(31-23)24-19-9-10-20(13-19)30-24/h7-8,11-12,19-20,24,30H,1,4,9-10,13H2,2-3,5-6H3,(H,29,31)/b14-11+,15-12+,21-8+ |
| InChIKey | WLKCZUPDNDOAIC-PMNYBKPZSA-N |
| XLogP | 6.51 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|