C25H29ClN4O2S — CID 145302672
N-[[4-chloro-3-[4-[4-(diethylaminosulfanyl)phenyl]-6-oxo-1H-pyrimidin-2-yl]phenyl]methyl]-2-methylpropanamide (PubChem CID 145302672) has the molecular formula C25H29ClN4O2S and a molecular weight of 485.05 g/mol. Its IUPAC name is N-[[4-chloro-3-[4-[4-(diethylaminosulfanyl)phenyl]-6-oxo-1H-pyrimidin-2-yl]phenyl]methyl]-2-methylpropanamide.
| Compound Name | N-[[4-chloro-3-[4-[4-(diethylaminosulfanyl)phenyl]-6-oxo-1H-pyrimidin-2-yl]phenyl]methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 145302672 |
| Molecular Formula | C25H29ClN4O2S |
| Molecular Weight | 485.05 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | N-[[4-chloro-3-[4-[4-(diethylaminosulfanyl)phenyl]-6-oxo-1H-pyrimidin-2-yl]phenyl]methyl]-2-methylpropanamide |
| SMILES | CCN(CC)Sc1ccc(-c2cc(=O)[nH]c(-c3cc(CNC(=O)C(C)C)ccc3Cl)n2)cc1 |
| InChI | InChI=1S/C25H29ClN4O2S/c1-5-30(6-2)33-19-10-8-18(9-11-19)22-14-23(31)29-24(28-22)20-13-17(7-12-21(20)26)15-27-25(32)16(3)4/h7-14,16H,5-6,15H2,1-4H3,(H,27,32)(H,28,29,31) |
| InChIKey | IUSLEOVWCMOSAJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.05 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|