C38H30N2 — CID 145302967
N-[4-[4-[3-[(Z)-but-1-en-3-ynyl]-2-methylindol-1-yl]phenyl]phenyl]-N-methyl-4-phenylaniline (PubChem CID 145302967) has the molecular formula C38H30N2 and a molecular weight of 514.67 g/mol. Its IUPAC name is N-[4-[4-[3-[(Z)-but-1-en-3-ynyl]-2-methylindol-1-yl]phenyl]phenyl]-N-methyl-4-phenylaniline.
| Compound Name | N-[4-[4-[3-[(Z)-but-1-en-3-ynyl]-2-methylindol-1-yl]phenyl]phenyl]-N-methyl-4-phenylaniline |
|---|---|
| PubChem CID | 145302967 |
| Molecular Formula | C38H30N2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | N-[4-[4-[3-[(Z)-but-1-en-3-ynyl]-2-methylindol-1-yl]phenyl]phenyl]-N-methyl-4-phenylaniline |
| SMILES | C#C/C=C\c1c(C)n(-c2ccc(-c3ccc(N(C)c4ccc(-c5ccccc5)cc4)cc3)cc2)c2ccccc12 |
| InChI | InChI=1S/C38H30N2/c1-4-5-13-36-28(2)40(38-15-10-9-14-37(36)38)35-26-20-32(21-27-35)31-18-24-34(25-19-31)39(3)33-22-16-30(17-23-33)29-11-7-6-8-12-29/h1,5-27H,2-3H3/b13-5- |
| InChIKey | XKWWHKBUYNTAEP-ACAGNQJTSA-N |
| XLogP | 9.69 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|