About 4-(1-fluoroethyl)-2,3-dihydro-1H-triazole
4-(1-fluoroethyl)-2,3-dihydro-1H-triazole (PubChem CID 145303685) has the molecular formula C4H8FN3
and a molecular weight of 117.13 g/mol. Its IUPAC name is 4-(1-fluoroethyl)-2,3-dihydro-1H-triazole.
Molecular Properties
| Compound Name | 4-(1-fluoroethyl)-2,3-dihydro-1H-triazole |
| PubChem CID | 145303685 |
| Molecular Formula | C4H8FN3 |
| Molecular Weight | 117.13 g/mol |
| Exact Mass | 117.07 |
| IUPAC Name | 4-(1-fluoroethyl)-2,3-dihydro-1H-triazole |
| SMILES | CC(F)C1=CNNN1 |
| InChI | InChI=1S/C4H8FN3/c1-3(5)4-2-6-8-7-4/h2-3,6-8H,1H3 |
| InChIKey | UBNODBIILNKDBU-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.13 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1-fluoroethyl)-2,3-dihydro-1H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-fluoroethyl)-2,3-dihydro-1H-triazole?
The IUPAC name of 4-(1-fluoroethyl)-2,3-dihydro-1H-triazole (CID 145303685) is 4-(1-fluoroethyl)-2,3-dihydro-1H-triazole.
What is the SMILES notation for 4-(1-fluoroethyl)-2,3-dihydro-1H-triazole?
The canonical SMILES for 4-(1-fluoroethyl)-2,3-dihydro-1H-triazole is CC(F)C1=CNNN1.
What is the InChIKey of 4-(1-fluoroethyl)-2,3-dihydro-1H-triazole?
The InChIKey is UBNODBIILNKDBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8FN3/c1-3(5)4-2-6-8-7-4/h2-3,6-8H,1H3.
What are the key properties of 4-(1-fluoroethyl)-2,3-dihydro-1H-triazole?
4-(1-fluoroethyl)-2,3-dihydro-1H-triazole has a molecular weight of 117.13 g/mol, XLogP of -0.20, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-fluoroethyl)-2,3-dihydro-1H-triazole is sourced from PubChem (CID 145303685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).