C27H33FN4O4 — CID 145303948
[3-fluoro-8-(2-oxa-5-azabicyclo[2.2.2]octan-5-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone (PubChem CID 145303948) has the molecular formula C27H33FN4O4 and a molecular weight of 496.58 g/mol. Its IUPAC name is [3-fluoro-8-(2-oxa-5-azabicyclo[2.2.2]octan-5-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone.
| Compound Name | [3-fluoro-8-(2-oxa-5-azabicyclo[2.2.2]octan-5-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone |
|---|---|
| PubChem CID | 145303948 |
| Molecular Formula | C27H33FN4O4 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | [3-fluoro-8-(2-oxa-5-azabicyclo[2.2.2]octan-5-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone |
| SMILES | CC(C)O[C@H]1CC[C@H](C(=O)N2Cc3cc(F)cnc3Nc3ccc(N4CC5CCC4CO5)cc32)OC1 |
| InChI | InChI=1S/C27H33FN4O4/c1-16(2)36-22-6-8-25(35-15-22)27(33)32-12-17-9-18(28)11-29-26(17)30-23-7-4-19(10-24(23)32)31-13-21-5-3-20(31)14-34-21/h4,7,9-11,16,20-22,25H,3,5-6,8,12-15H2,1-2H3,(H,29,30)/t20?,21?,22-,25+/m0/s1 |
| InChIKey | CHPQQBZYSJKTOZ-BBLPBDBVSA-N |
| XLogP | 4.15 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |