C12H22N2O — CID 145304489
acetaldehyde;ethane;3-methyl-4,5,6,7-tetrahydro-2H-indazole (PubChem CID 145304489) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is acetaldehyde;ethane;3-methyl-4,5,6,7-tetrahydro-2H-indazole.
| Compound Name | acetaldehyde;ethane;3-methyl-4,5,6,7-tetrahydro-2H-indazole |
|---|---|
| PubChem CID | 145304489 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | acetaldehyde;ethane;3-methyl-4,5,6,7-tetrahydro-2H-indazole |
| SMILES | CC.CC=O.Cc1[nH]nc2c1CCCC2 |
| InChI | InChI=1S/C8H12N2.C2H4O.C2H6/c1-6-7-4-2-3-5-8(7)10-9-6;1-2-3;1-2/h2-5H2,1H3,(H,9,10);2H,1H3;1-2H3 |
| InChIKey | CYPUBQIRTUXEDV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|