C12H20O — CID 14530451
(1S)-1-cyclohexyl-2-ethylbuta-2,3-dien-1-ol (PubChem CID 14530451) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (1S)-1-cyclohexyl-2-ethylbuta-2,3-dien-1-ol.
| Compound Name | (1S)-1-cyclohexyl-2-ethylbuta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 14530451 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (1S)-1-cyclohexyl-2-ethylbuta-2,3-dien-1-ol |
| SMILES | C=C=C(CC)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C12H20O/c1-3-10(4-2)12(13)11-8-6-5-7-9-11/h11-13H,1,4-9H2,2H3/t12-/m1/s1 |
| InChIKey | FVWUZWKSIUPSLO-GFCCVEGCSA-N |
| XLogP | 3.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |