C13H24N2O2 — CID 145304553
ethane;methoxymethane;3-methyl-4,5,6,7-tetrahydro-2H-indazole-6-carbaldehyde (PubChem CID 145304553) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is ethane;methoxymethane;3-methyl-4,5,6,7-tetrahydro-2H-indazole-6-carbaldehyde.
| Compound Name | ethane;methoxymethane;3-methyl-4,5,6,7-tetrahydro-2H-indazole-6-carbaldehyde |
|---|---|
| PubChem CID | 145304553 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | ethane;methoxymethane;3-methyl-4,5,6,7-tetrahydro-2H-indazole-6-carbaldehyde |
| SMILES | CC.COC.Cc1[nH]nc2c1CCC(C=O)C2 |
| InChI | InChI=1S/C9H12N2O.C2H6O.C2H6/c1-6-8-3-2-7(5-12)4-9(8)11-10-6;1-3-2;1-2/h5,7H,2-4H2,1H3,(H,10,11);1-2H3;1-2H3 |
| InChIKey | SHFBYVUYOXVNED-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|