About 7-hydrazinyl-1H-imidazo[4,5-b]pyridin-5-amine
7-hydrazinyl-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 14530463) has the molecular formula C6H8N6
and a molecular weight of 164.17 g/mol. Its IUPAC name is 7-hydrazinyl-1H-imidazo[4,5-b]pyridin-5-amine.
Molecular Properties
| Compound Name | 7-hydrazinyl-1H-imidazo[4,5-b]pyridin-5-amine |
| PubChem CID | 14530463 |
| Molecular Formula | C6H8N6 |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 7-hydrazinyl-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | NNc1cc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C6H8N6/c7-4-1-3(12-8)5-6(11-4)10-2-9-5/h1-2H,8H2,(H4,7,9,10,11,12) |
| InChIKey | SRVGRUDZIUEIGP-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-hydrazinyl-1H-imidazo[4,5-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydrazinyl-1H-imidazo[4,5-b]pyridin-5-amine?
The IUPAC name of 7-hydrazinyl-1H-imidazo[4,5-b]pyridin-5-amine (CID 14530463) is 7-hydrazinyl-1H-imidazo[4,5-b]pyridin-5-amine.
What is the SMILES notation for 7-hydrazinyl-1H-imidazo[4,5-b]pyridin-5-amine?
The canonical SMILES for 7-hydrazinyl-1H-imidazo[4,5-b]pyridin-5-amine is NNc1cc(N)nc2nc[nH]c12.
What is the InChIKey of 7-hydrazinyl-1H-imidazo[4,5-b]pyridin-5-amine?
The InChIKey is SRVGRUDZIUEIGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N6/c7-4-1-3(12-8)5-6(11-4)10-2-9-5/h1-2H,8H2,(H4,7,9,10,11,12).
What are the key properties of 7-hydrazinyl-1H-imidazo[4,5-b]pyridin-5-amine?
7-hydrazinyl-1H-imidazo[4,5-b]pyridin-5-amine has a molecular weight of 164.17 g/mol, XLogP of -0.17, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydrazinyl-1H-imidazo[4,5-b]pyridin-5-amine is sourced from PubChem (CID 14530463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).