About ethane;7-methyl-1,4-dioxa-6-azaspiro[4.4]nonane
ethane;7-methyl-1,4-dioxa-6-azaspiro[4.4]nonane (PubChem CID 145305443) has the molecular formula C11H25NO2
and a molecular weight of 203.33 g/mol. Its IUPAC name is ethane;7-methyl-1,4-dioxa-6-azaspiro[4.4]nonane.
Molecular Properties
| Compound Name | ethane;7-methyl-1,4-dioxa-6-azaspiro[4.4]nonane |
| PubChem CID | 145305443 |
| Molecular Formula | C11H25NO2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | ethane;7-methyl-1,4-dioxa-6-azaspiro[4.4]nonane |
| SMILES | CC.CC.CC1CCC2(N1)OCCO2 |
| InChI | InChI=1S/C7H13NO2.2C2H6/c1-6-2-3-7(8-6)9-4-5-10-7;2*1-2/h6,8H,2-5H2,1H3;2*1-2H3 |
| InChIKey | AHPVBUCDQVKBBI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;7-methyl-1,4-dioxa-6-azaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-methyl-1,4-dioxa-6-azaspiro[4.4]nonane?
The IUPAC name of ethane;7-methyl-1,4-dioxa-6-azaspiro[4.4]nonane (CID 145305443) is ethane;7-methyl-1,4-dioxa-6-azaspiro[4.4]nonane.
What is the SMILES notation for ethane;7-methyl-1,4-dioxa-6-azaspiro[4.4]nonane?
The canonical SMILES for ethane;7-methyl-1,4-dioxa-6-azaspiro[4.4]nonane is CC.CC.CC1CCC2(N1)OCCO2.
What is the InChIKey of ethane;7-methyl-1,4-dioxa-6-azaspiro[4.4]nonane?
The InChIKey is AHPVBUCDQVKBBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.2C2H6/c1-6-2-3-7(8-6)9-4-5-10-7;2*1-2/h6,8H,2-5H2,1H3;2*1-2H3.
What are the key properties of ethane;7-methyl-1,4-dioxa-6-azaspiro[4.4]nonane?
ethane;7-methyl-1,4-dioxa-6-azaspiro[4.4]nonane has a molecular weight of 203.33 g/mol, XLogP of 2.51, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-methyl-1,4-dioxa-6-azaspiro[4.4]nonane is sourced from PubChem (CID 145305443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).