C16H22N2O2 — CID 145305521
ethane;2-[2-(4-ethylphenyl)ethyl]-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 145305521) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is ethane;2-[2-(4-ethylphenyl)ethyl]-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | ethane;2-[2-(4-ethylphenyl)ethyl]-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 145305521 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | ethane;2-[2-(4-ethylphenyl)ethyl]-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | CC.CCc1ccc(CCc2nc(O)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C14H16N2O2.C2H6/c1-2-10-3-5-11(6-4-10)7-8-12-15-13(17)9-14(18)16-12;1-2/h3-6,9H,2,7-8H2,1H3,(H2,15,16,17,18);1-2H3 |
| InChIKey | VKIUZTMQLGGYKL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |