C26H34N4O2 — CID 145305764
(E)-N,2-dimethyl-4-prop-1-en-2-yliminobut-2-enamide;3-methyl-3-[2-methyl-4-(2-methylpyrimidin-5-yl)phenyl]butan-2-one (PubChem CID 145305764) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is (E)-N,2-dimethyl-4-prop-1-en-2-yliminobut-2-enamide;3-methyl-3-[2-methyl-4-(2-methylpyrimidin-5-yl)phenyl]butan-2-one.
| Compound Name | (E)-N,2-dimethyl-4-prop-1-en-2-yliminobut-2-enamide;3-methyl-3-[2-methyl-4-(2-methylpyrimidin-5-yl)phenyl]butan-2-one |
|---|---|
| PubChem CID | 145305764 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | (E)-N,2-dimethyl-4-prop-1-en-2-yliminobut-2-enamide;3-methyl-3-[2-methyl-4-(2-methylpyrimidin-5-yl)phenyl]butan-2-one |
| SMILES | C=C(C)/N=C/C=C(\C)C(=O)NC.CC(=O)C(C)(C)c1ccc(-c2cnc(C)nc2)cc1C |
| InChI | InChI=1S/C17H20N2O.C9H14N2O/c1-11-8-14(15-9-18-13(3)19-10-15)6-7-16(11)17(4,5)12(2)20;1-7(2)11-6-5-8(3)9(12)10-4/h6-10H,1-5H3;5-6H,1H2,2-4H3,(H,10,12)/b;8-5+,11-6+ |
| InChIKey | WWMZDRRYSQZFPA-LWSUPYEJSA-N |
| XLogP | 4.91 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|