C9H12N2O — CID 145305840
8-ethyl-3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazine (PubChem CID 145305840) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 8-ethyl-3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazine.
| Compound Name | 8-ethyl-3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazine |
|---|---|
| PubChem CID | 145305840 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 8-ethyl-3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazine |
| SMILES | CCc1cncc2c1OCCN2 |
| InChI | InChI=1S/C9H12N2O/c1-2-7-5-10-6-8-9(7)12-4-3-11-8/h5-6,11H,2-4H2,1H3 |
| InChIKey | QNZHCTZQJFNAAA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |