About 1,4-dichloro-2,3-bis(chloromethyl)but-2-ene
1,4-dichloro-2,3-bis(chloromethyl)but-2-ene (PubChem CID 14530626) has the molecular formula C6H8Cl4
and a molecular weight of 221.94 g/mol. Its IUPAC name is 1,4-dichloro-2,3-bis(chloromethyl)but-2-ene.
Molecular Properties
| Compound Name | 1,4-dichloro-2,3-bis(chloromethyl)but-2-ene |
| PubChem CID | 14530626 |
| Molecular Formula | C6H8Cl4 |
| Molecular Weight | 221.94 g/mol |
| Exact Mass | 219.94 |
| IUPAC Name | 1,4-dichloro-2,3-bis(chloromethyl)but-2-ene |
| SMILES | ClCC(CCl)=C(CCl)CCl |
| InChI | InChI=1S/C6H8Cl4/c7-1-5(2-8)6(3-9)4-10/h1-4H2 |
| InChIKey | KZVNMGNMUIBWIT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.94 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dichloro-2,3-bis(chloromethyl)but-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dichloro-2,3-bis(chloromethyl)but-2-ene?
The IUPAC name of 1,4-dichloro-2,3-bis(chloromethyl)but-2-ene (CID 14530626) is 1,4-dichloro-2,3-bis(chloromethyl)but-2-ene.
What is the SMILES notation for 1,4-dichloro-2,3-bis(chloromethyl)but-2-ene?
The canonical SMILES for 1,4-dichloro-2,3-bis(chloromethyl)but-2-ene is ClCC(CCl)=C(CCl)CCl.
What is the InChIKey of 1,4-dichloro-2,3-bis(chloromethyl)but-2-ene?
The InChIKey is KZVNMGNMUIBWIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Cl4/c7-1-5(2-8)6(3-9)4-10/h1-4H2.
What are the key properties of 1,4-dichloro-2,3-bis(chloromethyl)but-2-ene?
1,4-dichloro-2,3-bis(chloromethyl)but-2-ene has a molecular weight of 221.94 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dichloro-2,3-bis(chloromethyl)but-2-ene is sourced from PubChem (CID 14530626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).