C54H38N4S — CID 145306656
5-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-7,8-dihydrodibenzothiophen-2-yl]-7,7-dimethylindeno[2,1-b]carbazole (PubChem CID 145306656) has the molecular formula C54H38N4S and a molecular weight of 774.99 g/mol. Its IUPAC name is 5-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-7,8-dihydrodibenzothiophen-2-yl]-7,7-dimethylindeno[2,1-b]carbazole.
| Compound Name | 5-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-7,8-dihydrodibenzothiophen-2-yl]-7,7-dimethylindeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 145306656 |
| Molecular Formula | C54H38N4S |
| Molecular Weight | 774.99 g/mol |
| Exact Mass | 774.28 |
| IUPAC Name | 5-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-7,8-dihydrodibenzothiophen-2-yl]-7,7-dimethylindeno[2,1-b]carbazole |
| SMILES | CC1(C)c2ccccc2-c2cc3c4ccccc4n(-c4cc(-c5ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cc5)c5sc6c(c5c4)=CCCC=6)c3cc21 |
| InChI | InChI=1S/C54H38N4S/c1-54(2)45-22-12-9-19-38(45)42-31-43-39-20-10-13-23-47(39)58(48(43)32-46(42)54)37-29-41(50-44(30-37)40-21-11-14-24-49(40)59-50)33-25-27-36(28-26-33)53-56-51(34-15-5-3-6-16-34)55-52(57-53)35-17-7-4-8-18-35/h3-10,12-13,15-32H,11,14H2,1-2H3 |
| InChIKey | JJZKVWVXRZGCLZ-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.99 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |