About ethane;4-fluoro-1-pentylpiperidine;4-propylmorpholine
ethane;4-fluoro-1-pentylpiperidine;4-propylmorpholine (PubChem CID 145307293) has the molecular formula C19H41FN2O
and a molecular weight of 332.55 g/mol. Its IUPAC name is ethane;4-fluoro-1-pentylpiperidine;4-propylmorpholine.
Molecular Properties
| Compound Name | ethane;4-fluoro-1-pentylpiperidine;4-propylmorpholine |
| PubChem CID | 145307293 |
| Molecular Formula | C19H41FN2O |
| Molecular Weight | 332.55 g/mol |
| Exact Mass | 332.32 |
| IUPAC Name | ethane;4-fluoro-1-pentylpiperidine;4-propylmorpholine |
| SMILES | CC.CCCCCN1CCC(F)CC1.CCCN1CCOCC1 |
| InChI | InChI=1S/C10H20FN.C7H15NO.C2H6/c1-2-3-4-7-12-8-5-10(11)6-9-12;1-2-3-8-4-6-9-7-5-8;1-2/h10H,2-9H2,1H3;2-7H2,1H3;1-2H3 |
| InChIKey | DPOXTNGIHNOQNX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-fluoro-1-pentylpiperidine;4-propylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-fluoro-1-pentylpiperidine;4-propylmorpholine?
The IUPAC name of ethane;4-fluoro-1-pentylpiperidine;4-propylmorpholine (CID 145307293) is ethane;4-fluoro-1-pentylpiperidine;4-propylmorpholine.
What is the SMILES notation for ethane;4-fluoro-1-pentylpiperidine;4-propylmorpholine?
The canonical SMILES for ethane;4-fluoro-1-pentylpiperidine;4-propylmorpholine is CC.CCCCCN1CCC(F)CC1.CCCN1CCOCC1.
What is the InChIKey of ethane;4-fluoro-1-pentylpiperidine;4-propylmorpholine?
The InChIKey is DPOXTNGIHNOQNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20FN.C7H15NO.C2H6/c1-2-3-4-7-12-8-5-10(11)6-9-12;1-2-3-8-4-6-9-7-5-8;1-2/h10H,2-9H2,1H3;2-7H2,1H3;1-2H3.
What are the key properties of ethane;4-fluoro-1-pentylpiperidine;4-propylmorpholine?
ethane;4-fluoro-1-pentylpiperidine;4-propylmorpholine has a molecular weight of 332.55 g/mol, XLogP of 4.37, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-fluoro-1-pentylpiperidine;4-propylmorpholine is sourced from PubChem (CID 145307293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).