About 1-[[3-[(E)-but-1-enyl]phenyl]methyl]piperidin-4-amine;cyclopropylbenzene
1-[[3-[(E)-but-1-enyl]phenyl]methyl]piperidin-4-amine;cyclopropylbenzene (PubChem CID 145307553) has the molecular formula C25H34N2
and a molecular weight of 362.56 g/mol. Its IUPAC name is 1-[[3-[(E)-but-1-enyl]phenyl]methyl]piperidin-4-amine;cyclopropylbenzene.
Molecular Properties
| Compound Name | 1-[[3-[(E)-but-1-enyl]phenyl]methyl]piperidin-4-amine;cyclopropylbenzene |
| PubChem CID | 145307553 |
| Molecular Formula | C25H34N2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | 1-[[3-[(E)-but-1-enyl]phenyl]methyl]piperidin-4-amine;cyclopropylbenzene |
| SMILES | CC/C=C/c1cccc(CN2CCC(N)CC2)c1.c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C16H24N2.C9H10/c1-2-3-5-14-6-4-7-15(12-14)13-18-10-8-16(17)9-11-18;1-2-4-8(5-3-1)9-6-7-9/h3-7,12,16H,2,8-11,13,17H2,1H3;1-5,9H,6-7H2/b5-3+; |
| InChIKey | TWDBSPSWKDPJTH-WGCWOXMQSA-N |
| XLogP | 5.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[[3-[(E)-but-1-enyl]phenyl]methyl]piperidin-4-amine;cyclopropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3-[(E)-but-1-enyl]phenyl]methyl]piperidin-4-amine;cyclopropylbenzene?
The IUPAC name of 1-[[3-[(E)-but-1-enyl]phenyl]methyl]piperidin-4-amine;cyclopropylbenzene (CID 145307553) is 1-[[3-[(E)-but-1-enyl]phenyl]methyl]piperidin-4-amine;cyclopropylbenzene.
What is the SMILES notation for 1-[[3-[(E)-but-1-enyl]phenyl]methyl]piperidin-4-amine;cyclopropylbenzene?
The canonical SMILES for 1-[[3-[(E)-but-1-enyl]phenyl]methyl]piperidin-4-amine;cyclopropylbenzene is CC/C=C/c1cccc(CN2CCC(N)CC2)c1.c1ccc(C2CC2)cc1.
What is the InChIKey of 1-[[3-[(E)-but-1-enyl]phenyl]methyl]piperidin-4-amine;cyclopropylbenzene?
The InChIKey is TWDBSPSWKDPJTH-WGCWOXMQSA-N. The full InChI is InChI=1S/C16H24N2.C9H10/c1-2-3-5-14-6-4-7-15(12-14)13-18-10-8-16(17)9-11-18;1-2-4-8(5-3-1)9-6-7-9/h3-7,12,16H,2,8-11,13,17H2,1H3;1-5,9H,6-7H2/b5-3+;.
What are the key properties of 1-[[3-[(E)-but-1-enyl]phenyl]methyl]piperidin-4-amine;cyclopropylbenzene?
1-[[3-[(E)-but-1-enyl]phenyl]methyl]piperidin-4-amine;cyclopropylbenzene has a molecular weight of 362.56 g/mol, XLogP of 5.60, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3-[(E)-but-1-enyl]phenyl]methyl]piperidin-4-amine;cyclopropylbenzene is sourced from PubChem (CID 145307553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).