C19H30N2O2 — CID 145307586
tert-butyl N-(1-aminopentan-3-yl)-N-[(1R)-2-phenylcyclopropyl]carbamate (PubChem CID 145307586) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is tert-butyl N-(1-aminopentan-3-yl)-N-[(1R)-2-phenylcyclopropyl]carbamate.
| Compound Name | tert-butyl N-(1-aminopentan-3-yl)-N-[(1R)-2-phenylcyclopropyl]carbamate |
|---|---|
| PubChem CID | 145307586 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | tert-butyl N-(1-aminopentan-3-yl)-N-[(1R)-2-phenylcyclopropyl]carbamate |
| SMILES | CCC(CCN)N(C(=O)OC(C)(C)C)[C@@H]1CC1c1ccccc1 |
| InChI | InChI=1S/C19H30N2O2/c1-5-15(11-12-20)21(18(22)23-19(2,3)4)17-13-16(17)14-9-7-6-8-10-14/h6-10,15-17H,5,11-13,20H2,1-4H3/t15?,16?,17-/m1/s1 |
| InChIKey | TVBDTBKNBYGSPF-OFLPRAFFSA-N |
| XLogP | 3.91 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |