About ethane;3-methyl-6-nitrocyclohexa-3,5-diene-1,2-diimine
ethane;3-methyl-6-nitrocyclohexa-3,5-diene-1,2-diimine (PubChem CID 145307710) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is ethane;3-methyl-6-nitrocyclohexa-3,5-diene-1,2-diimine.
Molecular Properties
| Compound Name | ethane;3-methyl-6-nitrocyclohexa-3,5-diene-1,2-diimine |
| PubChem CID | 145307710 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | ethane;3-methyl-6-nitrocyclohexa-3,5-diene-1,2-diimine |
| SMILES | CC.[H]/N=C1/C([N+](=O)[O-])=CC=C(C)/C1=N\[H] |
| InChI | InChI=1S/C7H7N3O2.C2H6/c1-4-2-3-5(10(11)12)7(9)6(4)8;1-2/h2-3,8-9H,1H3;1-2H3/b8-6+,9-7-; |
| InChIKey | ZOLAOPPMIPEXJR-ULCBHPGJSA-N |
| XLogP | 2.17 |
| TPSA | 90.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methyl-6-nitrocyclohexa-3,5-diene-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-6-nitrocyclohexa-3,5-diene-1,2-diimine?
The IUPAC name of ethane;3-methyl-6-nitrocyclohexa-3,5-diene-1,2-diimine (CID 145307710) is ethane;3-methyl-6-nitrocyclohexa-3,5-diene-1,2-diimine.
What is the SMILES notation for ethane;3-methyl-6-nitrocyclohexa-3,5-diene-1,2-diimine?
The canonical SMILES for ethane;3-methyl-6-nitrocyclohexa-3,5-diene-1,2-diimine is CC.[H]/N=C1/C([N+](=O)[O-])=CC=C(C)/C1=N\[H].
What is the InChIKey of ethane;3-methyl-6-nitrocyclohexa-3,5-diene-1,2-diimine?
The InChIKey is ZOLAOPPMIPEXJR-ULCBHPGJSA-N. The full InChI is InChI=1S/C7H7N3O2.C2H6/c1-4-2-3-5(10(11)12)7(9)6(4)8;1-2/h2-3,8-9H,1H3;1-2H3/b8-6+,9-7-;.
What are the key properties of ethane;3-methyl-6-nitrocyclohexa-3,5-diene-1,2-diimine?
ethane;3-methyl-6-nitrocyclohexa-3,5-diene-1,2-diimine has a molecular weight of 195.22 g/mol, XLogP of 2.17, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-6-nitrocyclohexa-3,5-diene-1,2-diimine is sourced from PubChem (CID 145307710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).