About 2-butan-2-ylpyrrolidine;molecular hydrogen
2-butan-2-ylpyrrolidine;molecular hydrogen (PubChem CID 145307773) has the molecular formula C8H19N
and a molecular weight of 129.25 g/mol. Its IUPAC name is 2-butan-2-ylpyrrolidine;molecular hydrogen.
Molecular Properties
| Compound Name | 2-butan-2-ylpyrrolidine;molecular hydrogen |
| PubChem CID | 145307773 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.25 g/mol |
| Exact Mass | 129.15 |
| IUPAC Name | 2-butan-2-ylpyrrolidine;molecular hydrogen |
| SMILES | CCC(C)C1CCCN1.[H][H] |
| InChI | InChI=1S/C8H17N.H2/c1-3-7(2)8-5-4-6-9-8;/h7-9H,3-6H2,1-2H3;1H |
| InChIKey | KIHIBBPHOIBFMY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butan-2-ylpyrrolidine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-ylpyrrolidine;molecular hydrogen?
The IUPAC name of 2-butan-2-ylpyrrolidine;molecular hydrogen (CID 145307773) is 2-butan-2-ylpyrrolidine;molecular hydrogen.
What is the SMILES notation for 2-butan-2-ylpyrrolidine;molecular hydrogen?
The canonical SMILES for 2-butan-2-ylpyrrolidine;molecular hydrogen is CCC(C)C1CCCN1.[H][H].
What is the InChIKey of 2-butan-2-ylpyrrolidine;molecular hydrogen?
The InChIKey is KIHIBBPHOIBFMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.H2/c1-3-7(2)8-5-4-6-9-8;/h7-9H,3-6H2,1-2H3;1H.
What are the key properties of 2-butan-2-ylpyrrolidine;molecular hydrogen?
2-butan-2-ylpyrrolidine;molecular hydrogen has a molecular weight of 129.25 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-ylpyrrolidine;molecular hydrogen is sourced from PubChem (CID 145307773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).