C31H38N8 — CID 145308311
(3E,5E)-N-(3-methylpent-1-en-2-yl)-5-[3-[7-(4-methylpiperazin-1-yl)-3H-imidazo[4,5-c]pyridin-2-yl]-1H-indazol-5-yl]hepta-1,3,5-trien-3-amine (PubChem CID 145308311) has the molecular formula C31H38N8 and a molecular weight of 522.70 g/mol. Its IUPAC name is (3E,5E)-N-(3-methylpent-1-en-2-yl)-5-[3-[7-(4-methylpiperazin-1-yl)-3H-imidazo[4,5-c]pyridin-2-yl]-1H-indazol-5-yl]hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-N-(3-methylpent-1-en-2-yl)-5-[3-[7-(4-methylpiperazin-1-yl)-3H-imidazo[4,5-c]pyridin-2-yl]-1H-indazol-5-yl]hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145308311 |
| Molecular Formula | C31H38N8 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | (3E,5E)-N-(3-methylpent-1-en-2-yl)-5-[3-[7-(4-methylpiperazin-1-yl)-3H-imidazo[4,5-c]pyridin-2-yl]-1H-indazol-5-yl]hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C(=C/C)c1ccc2[nH]nc(-c3nc4c(N5CCN(C)CC5)cncc4[nH]3)c2c1)NC(=C)C(C)CC |
| InChI | InChI=1S/C31H38N8/c1-7-20(4)21(5)33-24(9-3)16-22(8-2)23-10-11-26-25(17-23)29(37-36-26)31-34-27-18-32-19-28(30(27)35-31)39-14-12-38(6)13-15-39/h8-11,16-20,33H,3,5,7,12-15H2,1-2,4,6H3,(H,34,35)(H,36,37)/b22-8+,24-16+ |
| InChIKey | GZHHTWOKZJNERC-SAPZMGRYSA-N |
| XLogP | 5.88 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|