About N-but-3-enyl-2,3-dihydro-1,3-benzothiazol-2-amine
N-but-3-enyl-2,3-dihydro-1,3-benzothiazol-2-amine (PubChem CID 145308863) has the molecular formula C11H14N2S
and a molecular weight of 206.31 g/mol. Its IUPAC name is N-but-3-enyl-2,3-dihydro-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | N-but-3-enyl-2,3-dihydro-1,3-benzothiazol-2-amine |
| PubChem CID | 145308863 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | N-but-3-enyl-2,3-dihydro-1,3-benzothiazol-2-amine |
| SMILES | C=CCCNC1Nc2ccccc2S1 |
| InChI | InChI=1S/C11H14N2S/c1-2-3-8-12-11-13-9-6-4-5-7-10(9)14-11/h2,4-7,11-13H,1,3,8H2 |
| InChIKey | GNTIZALIRBFADJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-but-3-enyl-2,3-dihydro-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-3-enyl-2,3-dihydro-1,3-benzothiazol-2-amine?
The IUPAC name of N-but-3-enyl-2,3-dihydro-1,3-benzothiazol-2-amine (CID 145308863) is N-but-3-enyl-2,3-dihydro-1,3-benzothiazol-2-amine.
What is the SMILES notation for N-but-3-enyl-2,3-dihydro-1,3-benzothiazol-2-amine?
The canonical SMILES for N-but-3-enyl-2,3-dihydro-1,3-benzothiazol-2-amine is C=CCCNC1Nc2ccccc2S1.
What is the InChIKey of N-but-3-enyl-2,3-dihydro-1,3-benzothiazol-2-amine?
The InChIKey is GNTIZALIRBFADJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2S/c1-2-3-8-12-11-13-9-6-4-5-7-10(9)14-11/h2,4-7,11-13H,1,3,8H2.
What are the key properties of N-but-3-enyl-2,3-dihydro-1,3-benzothiazol-2-amine?
N-but-3-enyl-2,3-dihydro-1,3-benzothiazol-2-amine has a molecular weight of 206.31 g/mol, XLogP of 2.65, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-3-enyl-2,3-dihydro-1,3-benzothiazol-2-amine is sourced from PubChem (CID 145308863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).