About 7,10-dibromophenanthro[9,10-b]pyrazine-2,3-dicarbonitrile
7,10-dibromophenanthro[9,10-b]pyrazine-2,3-dicarbonitrile (PubChem CID 145309497) has the molecular formula C18H6Br2N4
and a molecular weight of 438.08 g/mol. Its IUPAC name is 7,10-dibromophenanthro[9,10-b]pyrazine-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 7,10-dibromophenanthro[9,10-b]pyrazine-2,3-dicarbonitrile |
| PubChem CID | 145309497 |
| Molecular Formula | C18H6Br2N4 |
| Molecular Weight | 438.08 g/mol |
| Exact Mass | 435.90 |
| IUPAC Name | 7,10-dibromophenanthro[9,10-b]pyrazine-2,3-dicarbonitrile |
| SMILES | N#Cc1nc2c3ccc(Br)cc3c3cc(Br)ccc3c2nc1C#N |
| InChI | InChI=1S/C18H6Br2N4/c19-9-1-3-11-13(5-9)14-6-10(20)2-4-12(14)18-17(11)23-15(7-21)16(8-22)24-18/h1-6H |
| InChIKey | HGEGRKIBGXSHKP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.08 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 7,10-dibromophenanthro[9,10-b]pyrazine-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,10-dibromophenanthro[9,10-b]pyrazine-2,3-dicarbonitrile?
The IUPAC name of 7,10-dibromophenanthro[9,10-b]pyrazine-2,3-dicarbonitrile (CID 145309497) is 7,10-dibromophenanthro[9,10-b]pyrazine-2,3-dicarbonitrile.
What is the SMILES notation for 7,10-dibromophenanthro[9,10-b]pyrazine-2,3-dicarbonitrile?
The canonical SMILES for 7,10-dibromophenanthro[9,10-b]pyrazine-2,3-dicarbonitrile is N#Cc1nc2c3ccc(Br)cc3c3cc(Br)ccc3c2nc1C#N.
What is the InChIKey of 7,10-dibromophenanthro[9,10-b]pyrazine-2,3-dicarbonitrile?
The InChIKey is HGEGRKIBGXSHKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H6Br2N4/c19-9-1-3-11-13(5-9)14-6-10(20)2-4-12(14)18-17(11)23-15(7-21)16(8-22)24-18/h1-6H.
What are the key properties of 7,10-dibromophenanthro[9,10-b]pyrazine-2,3-dicarbonitrile?
7,10-dibromophenanthro[9,10-b]pyrazine-2,3-dicarbonitrile has a molecular weight of 438.08 g/mol, XLogP of 5.20, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,10-dibromophenanthro[9,10-b]pyrazine-2,3-dicarbonitrile is sourced from PubChem (CID 145309497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).