C15H29N — CID 145310316
(6Z)-pentadeca-1,6-dien-5-amine (PubChem CID 145310316) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is (6Z)-pentadeca-1,6-dien-5-amine.
| Compound Name | (6Z)-pentadeca-1,6-dien-5-amine |
|---|---|
| PubChem CID | 145310316 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | (6Z)-pentadeca-1,6-dien-5-amine |
| SMILES | C=CCCC(N)/C=C\CCCCCCCC |
| InChI | InChI=1S/C15H29N/c1-3-5-7-8-9-10-11-12-14-15(16)13-6-4-2/h4,12,14-15H,2-3,5-11,13,16H2,1H3/b14-12- |
| InChIKey | XADJKHYYGUQCQY-OWBHPGMISA-N |
| XLogP | 4.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|