C19H31NO4 — CID 145310522
tert-butyl N-[2-[(3Z,5Z,6E)-5-ethylidene-6-hydroxy-4-methylnona-1,3,6-trien-3-yl]oxyethyl]carbamate (PubChem CID 145310522) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is tert-butyl N-[2-[(3Z,5Z,6E)-5-ethylidene-6-hydroxy-4-methylnona-1,3,6-trien-3-yl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3Z,5Z,6E)-5-ethylidene-6-hydroxy-4-methylnona-1,3,6-trien-3-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 145310522 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | tert-butyl N-[2-[(3Z,5Z,6E)-5-ethylidene-6-hydroxy-4-methylnona-1,3,6-trien-3-yl]oxyethyl]carbamate |
| SMILES | C=C/C(OCCNC(=O)OC(C)(C)C)=C(C)/C(=C/C)C(/O)=C\CC |
| InChI | InChI=1S/C19H31NO4/c1-8-11-16(21)15(9-2)14(4)17(10-3)23-13-12-20-18(22)24-19(5,6)7/h9-11,21H,3,8,12-13H2,1-2,4-7H3,(H,20,22)/b15-9-,16-11+,17-14- |
| InChIKey | JGEDHYJDLYZWEV-FORBBXTLSA-N |
| XLogP | 4.79 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|