About 3-fluoro-6-methyl-1,7-dihydrocyclohepta[b]pyrrole
3-fluoro-6-methyl-1,7-dihydrocyclohepta[b]pyrrole (PubChem CID 145311612) has the molecular formula C10H10FN
and a molecular weight of 163.19 g/mol. Its IUPAC name is 3-fluoro-6-methyl-1,7-dihydrocyclohepta[b]pyrrole.
Molecular Properties
| Compound Name | 3-fluoro-6-methyl-1,7-dihydrocyclohepta[b]pyrrole |
| PubChem CID | 145311612 |
| Molecular Formula | C10H10FN |
| Molecular Weight | 163.19 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 3-fluoro-6-methyl-1,7-dihydrocyclohepta[b]pyrrole |
| SMILES | CC1=CC=c2c(F)c[nH]c2=CC1 |
| InChI | InChI=1S/C10H10FN/c1-7-2-4-8-9(11)6-12-10(8)5-3-7/h2,4-6,12H,3H2,1H3 |
| InChIKey | QLCISUOCHHYEOB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.19 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-fluoro-6-methyl-1,7-dihydrocyclohepta[b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-6-methyl-1,7-dihydrocyclohepta[b]pyrrole?
The IUPAC name of 3-fluoro-6-methyl-1,7-dihydrocyclohepta[b]pyrrole (CID 145311612) is 3-fluoro-6-methyl-1,7-dihydrocyclohepta[b]pyrrole.
What is the SMILES notation for 3-fluoro-6-methyl-1,7-dihydrocyclohepta[b]pyrrole?
The canonical SMILES for 3-fluoro-6-methyl-1,7-dihydrocyclohepta[b]pyrrole is CC1=CC=c2c(F)c[nH]c2=CC1.
What is the InChIKey of 3-fluoro-6-methyl-1,7-dihydrocyclohepta[b]pyrrole?
The InChIKey is QLCISUOCHHYEOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FN/c1-7-2-4-8-9(11)6-12-10(8)5-3-7/h2,4-6,12H,3H2,1H3.
What are the key properties of 3-fluoro-6-methyl-1,7-dihydrocyclohepta[b]pyrrole?
3-fluoro-6-methyl-1,7-dihydrocyclohepta[b]pyrrole has a molecular weight of 163.19 g/mol, XLogP of 1.06, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-6-methyl-1,7-dihydrocyclohepta[b]pyrrole is sourced from PubChem (CID 145311612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).