C25H21Cl2LiN4O2 — CID 145311801
lithium 4-[5-[(3aS,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]pyrrolo[2,3-b]pyridin-1-id-3-yl]-1-[(3,4-dichlorophenyl)methyl]pyridin-2-one (PubChem CID 145311801) has the molecular formula C25H21Cl2LiN4O2 and a molecular weight of 487.32 g/mol. Its IUPAC name is lithium 4-[5-[(3aS,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]pyrrolo[2,3-b]pyridin-1-id-3-yl]-1-[(3,4-dichlorophenyl)methyl]pyridin-2-one.
| Compound Name | lithium 4-[5-[(3aS,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]pyrrolo[2,3-b]pyridin-1-id-3-yl]-1-[(3,4-dichlorophenyl)methyl]pyridin-2-one |
|---|---|
| PubChem CID | 145311801 |
| Molecular Formula | C25H21Cl2LiN4O2 |
| Molecular Weight | 487.32 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | lithium 4-[5-[(3aS,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]pyrrolo[2,3-b]pyridin-1-id-3-yl]-1-[(3,4-dichlorophenyl)methyl]pyridin-2-one |
| SMILES | O=c1cc(-c2c[n-]c3ncc(N4C[C@H]5COC[C@H]5C4)cc23)ccn1Cc1ccc(Cl)c(Cl)c1.[Li+] |
| InChI | InChI=1S/C25H22Cl2N4O2.Li/c26-22-2-1-15(5-23(22)27)10-30-4-3-16(6-24(30)32)21-9-29-25-20(21)7-19(8-28-25)31-11-17-13-33-14-18(17)12-31;/h1-9,17-18H,10-14H2,(H,28,29,32);/q;+1/p-1/t17-,18+; |
| InChIKey | PPYRUWWAJGJISK-GNXQHMNLSA-M |
| XLogP | 1.46 |
| TPSA | 61.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|