About 4-amino-3-propan-2-yloxycyclohexa-1,5-diene-1-carbonitrile
4-amino-3-propan-2-yloxycyclohexa-1,5-diene-1-carbonitrile (PubChem CID 145312100) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is 4-amino-3-propan-2-yloxycyclohexa-1,5-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-amino-3-propan-2-yloxycyclohexa-1,5-diene-1-carbonitrile |
| PubChem CID | 145312100 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 4-amino-3-propan-2-yloxycyclohexa-1,5-diene-1-carbonitrile |
| SMILES | CC(C)OC1C=C(C#N)C=CC1N |
| InChI | InChI=1S/C10H14N2O/c1-7(2)13-10-5-8(6-11)3-4-9(10)12/h3-5,7,9-10H,12H2,1-2H3 |
| InChIKey | GAVTVJJCMQGNFR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-3-propan-2-yloxycyclohexa-1,5-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-propan-2-yloxycyclohexa-1,5-diene-1-carbonitrile?
The IUPAC name of 4-amino-3-propan-2-yloxycyclohexa-1,5-diene-1-carbonitrile (CID 145312100) is 4-amino-3-propan-2-yloxycyclohexa-1,5-diene-1-carbonitrile.
What is the SMILES notation for 4-amino-3-propan-2-yloxycyclohexa-1,5-diene-1-carbonitrile?
The canonical SMILES for 4-amino-3-propan-2-yloxycyclohexa-1,5-diene-1-carbonitrile is CC(C)OC1C=C(C#N)C=CC1N.
What is the InChIKey of 4-amino-3-propan-2-yloxycyclohexa-1,5-diene-1-carbonitrile?
The InChIKey is GAVTVJJCMQGNFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c1-7(2)13-10-5-8(6-11)3-4-9(10)12/h3-5,7,9-10H,12H2,1-2H3.
What are the key properties of 4-amino-3-propan-2-yloxycyclohexa-1,5-diene-1-carbonitrile?
4-amino-3-propan-2-yloxycyclohexa-1,5-diene-1-carbonitrile has a molecular weight of 178.23 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-propan-2-yloxycyclohexa-1,5-diene-1-carbonitrile is sourced from PubChem (CID 145312100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).