About 4-fluoro-2-hexan-2-yloxyaniline;5-methylpyrrolo[3,2-d]pyrimidine
4-fluoro-2-hexan-2-yloxyaniline;5-methylpyrrolo[3,2-d]pyrimidine (PubChem CID 145312121) has the molecular formula C19H25FN4O
and a molecular weight of 344.43 g/mol. Its IUPAC name is 4-fluoro-2-hexan-2-yloxyaniline;5-methylpyrrolo[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 4-fluoro-2-hexan-2-yloxyaniline;5-methylpyrrolo[3,2-d]pyrimidine |
| PubChem CID | 145312121 |
| Molecular Formula | C19H25FN4O |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 4-fluoro-2-hexan-2-yloxyaniline;5-methylpyrrolo[3,2-d]pyrimidine |
| SMILES | CCCCC(C)Oc1cc(F)ccc1N.Cn1ccc2ncncc21 |
| InChI | InChI=1S/C12H18FNO.C7H7N3/c1-3-4-5-9(2)15-12-8-10(13)6-7-11(12)14;1-10-3-2-6-7(10)4-8-5-9-6/h6-9H,3-5,14H2,1-2H3;2-5H,1H3 |
| InChIKey | VIKOZEMSMPEEJA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-2-hexan-2-yloxyaniline;5-methylpyrrolo[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2-hexan-2-yloxyaniline;5-methylpyrrolo[3,2-d]pyrimidine?
The IUPAC name of 4-fluoro-2-hexan-2-yloxyaniline;5-methylpyrrolo[3,2-d]pyrimidine (CID 145312121) is 4-fluoro-2-hexan-2-yloxyaniline;5-methylpyrrolo[3,2-d]pyrimidine.
What is the SMILES notation for 4-fluoro-2-hexan-2-yloxyaniline;5-methylpyrrolo[3,2-d]pyrimidine?
The canonical SMILES for 4-fluoro-2-hexan-2-yloxyaniline;5-methylpyrrolo[3,2-d]pyrimidine is CCCCC(C)Oc1cc(F)ccc1N.Cn1ccc2ncncc21.
What is the InChIKey of 4-fluoro-2-hexan-2-yloxyaniline;5-methylpyrrolo[3,2-d]pyrimidine?
The InChIKey is VIKOZEMSMPEEJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18FNO.C7H7N3/c1-3-4-5-9(2)15-12-8-10(13)6-7-11(12)14;1-10-3-2-6-7(10)4-8-5-9-6/h6-9H,3-5,14H2,1-2H3;2-5H,1H3.
What are the key properties of 4-fluoro-2-hexan-2-yloxyaniline;5-methylpyrrolo[3,2-d]pyrimidine?
4-fluoro-2-hexan-2-yloxyaniline;5-methylpyrrolo[3,2-d]pyrimidine has a molecular weight of 344.43 g/mol, XLogP of 4.33, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2-hexan-2-yloxyaniline;5-methylpyrrolo[3,2-d]pyrimidine is sourced from PubChem (CID 145312121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).