About (5E)-6-fluoro-4-propan-2-yloxyhexa-1,5-dien-3-amine
(5E)-6-fluoro-4-propan-2-yloxyhexa-1,5-dien-3-amine (PubChem CID 145312513) has the molecular formula C9H16FNO
and a molecular weight of 173.23 g/mol. Its IUPAC name is (5E)-6-fluoro-4-propan-2-yloxyhexa-1,5-dien-3-amine.
Molecular Properties
| Compound Name | (5E)-6-fluoro-4-propan-2-yloxyhexa-1,5-dien-3-amine |
| PubChem CID | 145312513 |
| Molecular Formula | C9H16FNO |
| Molecular Weight | 173.23 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (5E)-6-fluoro-4-propan-2-yloxyhexa-1,5-dien-3-amine |
| SMILES | C=CC(N)C(/C=C/F)OC(C)C |
| InChI | InChI=1S/C9H16FNO/c1-4-8(11)9(5-6-10)12-7(2)3/h4-9H,1,11H2,2-3H3/b6-5+ |
| InChIKey | QDHCTJBEOLWVCY-AATRIKPKSA-N |
| XLogP | 1.78 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-6-fluoro-4-propan-2-yloxyhexa-1,5-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-6-fluoro-4-propan-2-yloxyhexa-1,5-dien-3-amine?
The IUPAC name of (5E)-6-fluoro-4-propan-2-yloxyhexa-1,5-dien-3-amine (CID 145312513) is (5E)-6-fluoro-4-propan-2-yloxyhexa-1,5-dien-3-amine.
What is the SMILES notation for (5E)-6-fluoro-4-propan-2-yloxyhexa-1,5-dien-3-amine?
The canonical SMILES for (5E)-6-fluoro-4-propan-2-yloxyhexa-1,5-dien-3-amine is C=CC(N)C(/C=C/F)OC(C)C.
What is the InChIKey of (5E)-6-fluoro-4-propan-2-yloxyhexa-1,5-dien-3-amine?
The InChIKey is QDHCTJBEOLWVCY-AATRIKPKSA-N. The full InChI is InChI=1S/C9H16FNO/c1-4-8(11)9(5-6-10)12-7(2)3/h4-9H,1,11H2,2-3H3/b6-5+.
What are the key properties of (5E)-6-fluoro-4-propan-2-yloxyhexa-1,5-dien-3-amine?
(5E)-6-fluoro-4-propan-2-yloxyhexa-1,5-dien-3-amine has a molecular weight of 173.23 g/mol, XLogP of 1.78, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-6-fluoro-4-propan-2-yloxyhexa-1,5-dien-3-amine is sourced from PubChem (CID 145312513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).