About (3E,5Z)-2-hydroxy-3-prop-1-en-2-ylhepta-3,5-dienenitrile
(3E,5Z)-2-hydroxy-3-prop-1-en-2-ylhepta-3,5-dienenitrile (PubChem CID 145312656) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is (3E,5Z)-2-hydroxy-3-prop-1-en-2-ylhepta-3,5-dienenitrile.
Molecular Properties
| Compound Name | (3E,5Z)-2-hydroxy-3-prop-1-en-2-ylhepta-3,5-dienenitrile |
| PubChem CID | 145312656 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (3E,5Z)-2-hydroxy-3-prop-1-en-2-ylhepta-3,5-dienenitrile |
| SMILES | C=C(C)/C(=C\C=C/C)C(O)C#N |
| InChI | InChI=1S/C10H13NO/c1-4-5-6-9(8(2)3)10(12)7-11/h4-6,10,12H,2H2,1,3H3/b5-4-,9-6+ |
| InChIKey | MMNRFMKOIYMOKC-KMOPYBJPSA-N |
| XLogP | 1.95 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5Z)-2-hydroxy-3-prop-1-en-2-ylhepta-3,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5Z)-2-hydroxy-3-prop-1-en-2-ylhepta-3,5-dienenitrile?
The IUPAC name of (3E,5Z)-2-hydroxy-3-prop-1-en-2-ylhepta-3,5-dienenitrile (CID 145312656) is (3E,5Z)-2-hydroxy-3-prop-1-en-2-ylhepta-3,5-dienenitrile.
What is the SMILES notation for (3E,5Z)-2-hydroxy-3-prop-1-en-2-ylhepta-3,5-dienenitrile?
The canonical SMILES for (3E,5Z)-2-hydroxy-3-prop-1-en-2-ylhepta-3,5-dienenitrile is C=C(C)/C(=C\C=C/C)C(O)C#N.
What is the InChIKey of (3E,5Z)-2-hydroxy-3-prop-1-en-2-ylhepta-3,5-dienenitrile?
The InChIKey is MMNRFMKOIYMOKC-KMOPYBJPSA-N. The full InChI is InChI=1S/C10H13NO/c1-4-5-6-9(8(2)3)10(12)7-11/h4-6,10,12H,2H2,1,3H3/b5-4-,9-6+.
What are the key properties of (3E,5Z)-2-hydroxy-3-prop-1-en-2-ylhepta-3,5-dienenitrile?
(3E,5Z)-2-hydroxy-3-prop-1-en-2-ylhepta-3,5-dienenitrile has a molecular weight of 163.22 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5Z)-2-hydroxy-3-prop-1-en-2-ylhepta-3,5-dienenitrile is sourced from PubChem (CID 145312656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).