C17H30F2O — CID 145312681
(4S)-3,4-difluoro-2-methoxy-6,9-dimethyl-5-methylidenetridec-1-ene (PubChem CID 145312681) has the molecular formula C17H30F2O and a molecular weight of 288.42 g/mol. Its IUPAC name is (4S)-3,4-difluoro-2-methoxy-6,9-dimethyl-5-methylidenetridec-1-ene.
| Compound Name | (4S)-3,4-difluoro-2-methoxy-6,9-dimethyl-5-methylidenetridec-1-ene |
|---|---|
| PubChem CID | 145312681 |
| Molecular Formula | C17H30F2O |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | (4S)-3,4-difluoro-2-methoxy-6,9-dimethyl-5-methylidenetridec-1-ene |
| SMILES | C=C(OC)C(F)[C@@H](F)C(=C)C(C)CCC(C)CCCC |
| InChI | InChI=1S/C17H30F2O/c1-7-8-9-12(2)10-11-13(3)14(4)16(18)17(19)15(5)20-6/h12-13,16-17H,4-5,7-11H2,1-3,6H3/t12?,13?,16-,17?/m0/s1 |
| InChIKey | UUTPOGNBTFFCSW-XFCAVVGMSA-N |
| XLogP | 5.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|