C25H26FNS — CID 145312714
S-[4-[3-fluoro-4-[4-(4-methylcyclohexyl)phenyl]phenyl]phenyl]thiohydroxylamine (PubChem CID 145312714) has the molecular formula C25H26FNS and a molecular weight of 391.56 g/mol. Its IUPAC name is S-[4-[3-fluoro-4-[4-(4-methylcyclohexyl)phenyl]phenyl]phenyl]thiohydroxylamine.
| Compound Name | S-[4-[3-fluoro-4-[4-(4-methylcyclohexyl)phenyl]phenyl]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 145312714 |
| Molecular Formula | C25H26FNS |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | S-[4-[3-fluoro-4-[4-(4-methylcyclohexyl)phenyl]phenyl]phenyl]thiohydroxylamine |
| SMILES | CC1CCC(c2ccc(-c3ccc(-c4ccc(SN)cc4)cc3F)cc2)CC1 |
| InChI | InChI=1S/C25H26FNS/c1-17-2-4-18(5-3-17)19-6-8-21(9-7-19)24-15-12-22(16-25(24)26)20-10-13-23(28-27)14-11-20/h6-18H,2-5,27H2,1H3 |
| InChIKey | IKLRQFFDXBBHPO-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|