About 2-(ethylideneamino)ethyl acetate
2-(ethylideneamino)ethyl acetate (PubChem CID 145312863) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is 2-(ethylideneamino)ethyl acetate.
Molecular Properties
| Compound Name | 2-(ethylideneamino)ethyl acetate |
| PubChem CID | 145312863 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 2-(ethylideneamino)ethyl acetate |
| SMILES | C/C=N/CCOC(C)=O |
| InChI | InChI=1S/C6H11NO2/c1-3-7-4-5-9-6(2)8/h3H,4-5H2,1-2H3/b7-3+ |
| InChIKey | SCBCEMVNVVGXAC-XVNBXDOJSA-N |
| XLogP | 0.64 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(ethylideneamino)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylideneamino)ethyl acetate?
The IUPAC name of 2-(ethylideneamino)ethyl acetate (CID 145312863) is 2-(ethylideneamino)ethyl acetate.
What is the SMILES notation for 2-(ethylideneamino)ethyl acetate?
The canonical SMILES for 2-(ethylideneamino)ethyl acetate is C/C=N/CCOC(C)=O.
What is the InChIKey of 2-(ethylideneamino)ethyl acetate?
The InChIKey is SCBCEMVNVVGXAC-XVNBXDOJSA-N. The full InChI is InChI=1S/C6H11NO2/c1-3-7-4-5-9-6(2)8/h3H,4-5H2,1-2H3/b7-3+.
What are the key properties of 2-(ethylideneamino)ethyl acetate?
2-(ethylideneamino)ethyl acetate has a molecular weight of 129.16 g/mol, XLogP of 0.64, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylideneamino)ethyl acetate is sourced from PubChem (CID 145312863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).