About dimethyl 2-prop-2-enyl-2,4-bis(trimethylsilyl)pentanedioate
dimethyl 2-prop-2-enyl-2,4-bis(trimethylsilyl)pentanedioate (PubChem CID 14531357) has the molecular formula C16H32O4Si2
and a molecular weight of 344.60 g/mol. Its IUPAC name is dimethyl 2-prop-2-enyl-2,4-bis(trimethylsilyl)pentanedioate.
Molecular Properties
| Compound Name | dimethyl 2-prop-2-enyl-2,4-bis(trimethylsilyl)pentanedioate |
| PubChem CID | 14531357 |
| Molecular Formula | C16H32O4Si2 |
| Molecular Weight | 344.60 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | dimethyl 2-prop-2-enyl-2,4-bis(trimethylsilyl)pentanedioate |
| SMILES | C=CCC(CC(C(=O)OC)[Si](C)(C)C)(C(=O)OC)[Si](C)(C)C |
| InChI | InChI=1S/C16H32O4Si2/c1-10-11-16(15(18)20-3,22(7,8)9)12-13(14(17)19-2)21(4,5)6/h10,13H,1,11-12H2,2-9H3 |
| InChIKey | FJUFNZVALUFQCP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-prop-2-enyl-2,4-bis(trimethylsilyl)pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-prop-2-enyl-2,4-bis(trimethylsilyl)pentanedioate?
The IUPAC name of dimethyl 2-prop-2-enyl-2,4-bis(trimethylsilyl)pentanedioate (CID 14531357) is dimethyl 2-prop-2-enyl-2,4-bis(trimethylsilyl)pentanedioate.
What is the SMILES notation for dimethyl 2-prop-2-enyl-2,4-bis(trimethylsilyl)pentanedioate?
The canonical SMILES for dimethyl 2-prop-2-enyl-2,4-bis(trimethylsilyl)pentanedioate is C=CCC(CC(C(=O)OC)[Si](C)(C)C)(C(=O)OC)[Si](C)(C)C.
What is the InChIKey of dimethyl 2-prop-2-enyl-2,4-bis(trimethylsilyl)pentanedioate?
The InChIKey is FJUFNZVALUFQCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O4Si2/c1-10-11-16(15(18)20-3,22(7,8)9)12-13(14(17)19-2)21(4,5)6/h10,13H,1,11-12H2,2-9H3.
What are the key properties of dimethyl 2-prop-2-enyl-2,4-bis(trimethylsilyl)pentanedioate?
dimethyl 2-prop-2-enyl-2,4-bis(trimethylsilyl)pentanedioate has a molecular weight of 344.60 g/mol, XLogP of 4.09, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-prop-2-enyl-2,4-bis(trimethylsilyl)pentanedioate is sourced from PubChem (CID 14531357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).